CAS 71888-70-5
:permetin A
Description:
Permetin A, with the CAS number 71888-70-5, is a synthetic chemical compound belonging to the class of pyrethroids, which are widely used as insecticides. It is characterized by its ability to disrupt the nervous system of insects, leading to paralysis and death. Permetin A exhibits a high level of potency against a variety of pests, making it effective in agricultural and household applications. The compound is typically formulated as a liquid or aerosol and is known for its relatively low toxicity to mammals and birds, which enhances its appeal for use in integrated pest management. Its stability under various environmental conditions allows for prolonged efficacy, although it is sensitive to degradation by ultraviolet light. Additionally, permethrin A is often subject to regulatory scrutiny due to potential environmental impacts and the development of resistance in target pest populations. Proper handling and application are essential to minimize risks to non-target organisms and to ensure effective pest control.
Formula:C55H94N12O11
InChI:InChI=1/C54H92N12O12/c1-11-32(9)42-27-43(68)58-35(18-21-55)47(70)66-45(33(10)12-2)53(76)60-36(19-22-56)46(69)62-40(26-34-16-14-13-15-17-34)51(74)61-38(24-29(3)4)49(72)59-37(20-23-57)48(71)65-44(31(7)8)52(75)63-39(25-30(5)6)50(73)64-41(28-67)54(77)78-42/h13-17,29-33,35-42,44-45,67H,11-12,18-28,55-57H2,1-10H3,(H,58,68)(H,59,72)(H,60,76)(H,61,74)(H,62,69)(H,63,75)(H,64,73)(H,65,71)(H,66,70)
Synonyms:- permetin A
- See more synonyms
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Permetin A
CAS:Permetin A is a peptide antibiotic. It exhibits activity against Gram-negative bacteria, Gram-positive bacteria, and anaerobic bacteria.Formula:C54H92N12O12Color and Shape:SolidMolecular weight:1101.38
