CAS 71888-89-6
:1,2-Benzenedicarboxylic acid, di-C6-8-branched alkyl esters, C7-rich
Description:
1,2-Benzenedicarboxylic acid, di-C6-8-branched alkyl esters, commonly referred to as a type of phthalate ester, is a chemical compound characterized by its structure, which includes two carboxylic acid groups attached to a benzene ring, with branched alkyl chains ranging from six to eight carbon atoms. This compound is primarily used as a plasticizer, enhancing the flexibility and durability of plastics, particularly polyvinyl chloride (PVC). Its branched alkyl chains contribute to its low volatility and high thermal stability, making it suitable for various applications in the manufacturing of flexible materials. Additionally, it exhibits good compatibility with a wide range of polymers and can improve the mechanical properties of the final products. The "C7-rich" designation indicates a predominance of heptane-length alkyl chains in its composition. As with many phthalate esters, there are ongoing discussions regarding its environmental impact and potential health effects, leading to regulatory scrutiny in certain regions. Overall, this compound plays a significant role in the plastics industry while also raising considerations for safety and sustainability.
Formula:Unspecified
InChI:InChI=1/C22H34O4/c1-17(2)11-7-9-15-25-21(23)19-13-5-6-14-20(19)22(24)26-16-10-8-12-18(3)4/h5-6,13-14,17-18H,7-12,15-16H2,1-4H3
SMILES:CC(C)CCCCOC(=O)c1ccccc1C(=O)OCCCCC(C)C
Synonyms:- 1,2-Benzenedicarboxylic acid, di-C6-8-branched alkyl esters, C7-rich
- 1,2-Benzenedicarboxylic acid, di-C<sub>6-8</sub>-branched alkyl esters, C<sub>7</sub>-rich
- Bis(5-Methylhexyl) Benzene-1,2-Dicarboxylate
- C7-Rich di-C6-8-branched alkyl phthalates
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
1,2-Benzenedicarboxylic acid, di-C6-8-branched alkyl esters, C7-rich
CAS:Formula:C22H34O4Purity:%Color and Shape:LiquidMolecular weight:362.503Diisoheptyl phthalate
CAS:Formula:C24H40O4Purity:(Titration) ≥ 99.0%Color and Shape:Colourless liquidMolecular weight:362.50Phthalic acid, bis-C6-C8-branched alkyl esters C7-rich
CAS:Controlled ProductFormula:C22H34O4Color and Shape:NeatMolecular weight:362.5GB/T 20388-2016 Phthalates Mixture 572 1000-5000 µg/mL in Hexane
CAS:Controlled ProductColor and Shape:MixtureDiisoheptyl Phthalate (mixture of C7 isomers)
CAS:Formula:C22H34O4Color and Shape:NeatMolecular weight:362.5Diisoheptyl Phthalate (mixture of C7 primary and secondary chains)
CAS:Controlled ProductFormula:C22H34O4Color and Shape:NeatMolecular weight:362.5




