CAS 71889-75-3
:1H-indole-5-carboximidamide
Description:
1H-Indole-5-carboximidamide, identified by its CAS number 71889-75-3, is a chemical compound characterized by its indole structure, which consists of a fused benzene and pyrrole ring. This compound features a carboximidamide functional group at the 5-position of the indole ring, contributing to its unique reactivity and potential biological activity. It is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the presence of the carboximidamide group, which can engage in hydrogen bonding. The compound is of interest in medicinal chemistry and research due to its potential applications in pharmaceuticals, particularly in the development of drugs targeting various biological pathways. Its properties, such as melting point, boiling point, and specific reactivity, can vary based on the purity and specific formulation. As with many indole derivatives, it may also exhibit fluorescence and other optical properties, making it useful in various analytical applications. Safety and handling precautions should be observed, as with all chemical substances, to mitigate any potential hazards.
Formula:C9H9N3
InChI:InChI=1/C9H9N3/c10-9(11)7-1-2-8-6(5-7)3-4-12-8/h1-5,12H,(H3,10,11)
SMILES:c1cc2c(cc[nH]2)cc1C(=N)N
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
