CAS 71897-07-9
:tyrphostin ag 1295
Description:
Tyrphostin AG 1295 is a synthetic compound that functions primarily as a selective inhibitor of receptor tyrosine kinases, particularly the insulin receptor. It is classified as a tyrphostin, a group of compounds known for their ability to interfere with signal transduction pathways involved in cell growth and differentiation. This compound has been studied for its potential therapeutic applications, particularly in the context of cancer research and metabolic disorders, due to its role in modulating insulin signaling. Tyrphostin AG 1295 is characterized by its ability to inhibit cellular processes that are often dysregulated in various diseases. The compound is typically used in laboratory settings for research purposes, and its effects can vary depending on the specific cellular context and concentration used. As with many chemical substances, safety and handling precautions are essential when working with tyrphostin AG 1295, as it may pose health risks if not managed properly.
Formula:C16H14N2
InChI:InChI=1/C16H14N2/c1-11-8-14-15(9-12(11)2)18-16(10-17-14)13-6-4-3-5-7-13/h3-10H,1-2H3
SMILES:Cc1cc2c(cc1C)nc(cn2)c1ccccc1
Synonyms:- Ag 1295
- 6,7-Dimethyl-2-Phenylquinoxaline
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
AG 1295
CAS:AG 1295 is a selective PDGFR tyrosine-kinase inhibitor; it blocks PDGFR autophosphorylation without affecting EGF receptor.Formula:C16H14N2Purity:99.64%Color and Shape:SolidMolecular weight:234.3AG-1295
CAS:Controlled ProductApplications AG-1295 is a protein tyrosine kinase inhibitor. Antiproliferative agent used in the treatment of atherosclerosis, pulmonary fibrosis, and gliomas.
References Levitzki, A. et al.: Science, 267, 1782 (1995);Formula:C16H14N2Color and Shape:NeatMolecular weight:234.3AG 1295
CAS:AG 1295 is a growth factor that binds to the tyrosine kinase receptor. It is also a potent inhibitor of the receptor activity of PDGF-BB and other tyrosine kinases. AG 1295 was originally developed as an eluting agent for protein purification, but has been shown to have therapeutic potential for vascular injury repair and angiogenesis. The drug can be used in vitro to inhibit the phosphorylation of PDGF-BB by blocking its binding to the PDGF-BB receptor.Formula:C16H14N2Purity:Min. 95%Molecular weight:234.3 g/mol



