CymitQuimica logo

CAS 71897-59-1

:

4-(pyridin-2-ylmethyl)morpholine

Description:
4-(Pyridin-2-ylmethyl)morpholine, with the CAS number 71897-59-1, is a chemical compound characterized by its unique structure that combines a morpholine ring with a pyridine moiety. Morpholine is a six-membered ring containing both oxygen and nitrogen, while the pyridine component introduces aromatic characteristics. This compound typically exhibits properties such as moderate solubility in polar solvents due to the presence of both nitrogen atoms and the polar morpholine structure. It may also display basicity due to the nitrogen atoms, which can participate in protonation reactions. The presence of the pyridine ring can enhance its ability to engage in π-π stacking interactions and hydrogen bonding, making it potentially useful in various applications, including pharmaceuticals and agrochemicals. Additionally, the compound may exhibit biological activity, which could be explored in medicinal chemistry. As with many nitrogen-containing heterocycles, it is important to handle this compound with care, considering potential toxicity and reactivity.
Formula:C10H14N2O
InChI:InChI=1/C10H14N2O/c1-2-4-11-10(3-1)9-12-5-7-13-8-6-12/h1-4H,5-9H2
SMILES:c1ccnc(c1)CN1CCOCC1
Synonyms:
  • Morpholine, 4-(2-Pyridinylmethyl)-
  • 4-(Pyridin-2-ylmethyl)morpholine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.