CymitQuimica logo

CAS 71898-69-6

:

3-(acetylamino)pyrazine-2-carboxamide

Description:
3-(Acetylamino)pyrazine-2-carboxamide, with the CAS number 71898-69-6, is a chemical compound that features a pyrazine ring, which is a six-membered aromatic heterocycle containing two nitrogen atoms. This compound is characterized by the presence of an acetylamino group and a carboxamide functional group, contributing to its potential as a bioactive molecule. The acetylamino group enhances its solubility and reactivity, while the carboxamide group can participate in hydrogen bonding, influencing its interactions in biological systems. The compound may exhibit various pharmacological properties, making it of interest in medicinal chemistry. Its structural features suggest potential applications in drug development, particularly in targeting specific biological pathways. Additionally, the presence of nitrogen atoms in the pyrazine ring can affect the compound's electronic properties, influencing its reactivity and stability. Overall, 3-(acetylamino)pyrazine-2-carboxamide represents a versatile scaffold for further chemical modifications and investigations in various fields, including pharmaceuticals and agrochemicals.
Formula:C7H8N4O2
InChI:InChI=1/C7H8N4O2/c1-4(12)11-7-5(6(8)13)9-2-3-10-7/h2-3H,1H3,(H2,8,13)(H,10,11,12)
Synonyms:
  • 3-Acetamidopyrazine-2-carboxamide
  • 2-pyrazinecarboxamide, 3-(acetylamino)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.