CAS 719-41-5
:1-hydroxy-9H-xanthen-9-one
Description:
1-Hydroxy-9H-xanthen-9-one, also known as fluorescein, is a synthetic organic compound characterized by its vibrant fluorescent properties. It appears as a yellow-green powder or crystalline solid and is soluble in water, alcohol, and other organic solvents. The compound features a xanthene core with a hydroxyl group at the 1-position, contributing to its chemical reactivity and fluorescence. It has applications in various fields, including biology, where it is used as a fluorescent tracer in microscopy and flow cytometry, and in analytical chemistry for detecting pH changes and as a dye. The compound exhibits strong absorption in the visible spectrum, particularly in the blue-green region, and emits bright green light when excited, making it valuable for imaging and labeling purposes. Additionally, fluorescein is known for its stability under normal conditions, although it can degrade under extreme pH or light exposure. Its versatility and distinct optical properties make it a widely utilized substance in scientific research and industrial applications.
Formula:C13H8O3
InChI:InChI=1/C13H8O3/c14-9-5-3-7-11-12(9)13(15)8-4-1-2-6-10(8)16-11/h1-7,14H
SMILES:c1ccc2c(c1)c(=O)c1c(cccc1o2)O
Synonyms:- 1-Hydroxyxanthone
- 9H-xanthen-9-one, 1-hydroxy-
- Xanthen-9-one, 1-hydroxy-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
1-Hydroxyxanthone
CAS:<p>1-Hydroxyxanthone is a synthetic xanthone derivative, which is a type of organic compound known for its diverse bioactive properties. Derived from natural sources such as plants in the Guttiferae family, xanthones are renowned for their therapeutic potential. 1-Hydroxyxanthone specifically is obtained through chemical synthesis, allowing for greater purity and batch-to-batch consistency, which is beneficial for scientific research.</p>Formula:C13H8O3Purity:Min. 95%Color and Shape:PowderMolecular weight:212.2 g/mol
