CAS 71902-47-1

PGD3

Description:

PGD3, or Prostaglandin D3, is a naturally occurring lipid compound that plays a significant role in various physiological processes within the body. It is a member of the prostaglandin family, which are bioactive lipids derived from arachidonic acid. PGD3 is known for its involvement in mediating inflammatory responses, regulating blood pressure, and influencing immune system functions. The compound exhibits various biological activities, including vasodilation and modulation of platelet aggregation. PGD3 is less commonly studied compared to other prostaglandins, such as PGD2, but it is recognized for its potential therapeutic applications, particularly in the context of cardiovascular health and inflammation. Its chemical structure features a cyclopentane ring and multiple functional groups, which contribute to its reactivity and biological activity. As with other prostaglandins, PGD3 is typically synthesized in the body and can be measured in various biological samples, making it a subject of interest in pharmacological and biomedical research.

Formula: C₂₀H₃₀O₅

InChI: InChI=1S/C20H30O5/c1-2-3-6-9-15(21)12-13-17-16(18(22)14-19(17)23)10-7-4-5-8-11-20(24)25/h3-4,6-7,12-13,15-18,21-22H,2,5,8-11,14H2,1H3,(H,24,25)/b6-3-,7-4-,13-12+/t15-,16+,17+,18-/m0/s1

InChI key: InChIKey=ANOICLBSJIMQTA-WXGBOJPQSA-N

SMILES: C(/C=C\CCCC(O)=O)[C@@H]1[C@@H](/C=C/[C@H](C/C=C\CC)O)C(=O)C[C@@H]1O

Synonyms:

• PGD3
• (5Z,9α,13E,15S,17Z)-9,15-Dihydroxy-11-oxoprosta-5,13,17-trien-1-oic acid
• Prostaglandin D3
• Prosta-5,13,17-trien-1-oic acid, 9,15-dihydroxy-11-oxo-, (5Z,9α,13E,15S,17Z)-

Prostaglandin D3

CAS: 71902-47-1

Prostaglandin D3 (PGD3) functions as an inhibitor of platelet aggregation and modulates autonomic neurotransmission in humans [1].

Formula: C₂₀H₃₀O₅

Purity: 98%

Color and Shape: Solid

Molecular weight: 350.45

Ref: TM-T78584