
CAS 71916-71-7
:1′-(Phenylmethyl)spiro[benzofuran-2(3H),4′-piperidine]
Description:
1′-(Phenylmethyl)spiro[benzofuran-2(3H),4′-piperidine], with the CAS number 71916-71-7, is a chemical compound characterized by its unique spirocyclic structure, which combines a benzofuran moiety with a piperidine ring. This compound features a phenylmethyl group that contributes to its aromatic properties and potential biological activity. The spiro arrangement indicates that the two rings share a single atom, which can influence the compound's three-dimensional conformation and reactivity. Typically, compounds of this nature may exhibit interesting pharmacological properties, making them of interest in medicinal chemistry. The presence of both the benzofuran and piperidine components suggests potential interactions with biological targets, possibly influencing neurotransmitter systems or other cellular pathways. Additionally, the compound's solubility, stability, and reactivity can be influenced by the functional groups present, which may affect its application in various chemical and pharmaceutical contexts. Overall, this compound represents a fascinating intersection of organic chemistry and potential therapeutic applications.
Formula:C19H21NO
InChI:InChI=1S/C19H21NO/c1-2-6-16(7-3-1)15-20-12-10-19(11-13-20)14-17-8-4-5-9-18(17)21-19/h1-9H,10-15H2
InChI key:InChIKey=VWJFZEZXAHDEEL-UHFFFAOYSA-N
SMILES:C(N1CCC2(CC=3C(O2)=CC=CC3)CC1)C4=CC=CC=C4
Synonyms:- 1′-(Phenylmethyl)spiro[benzofuran-2(3H),4′-piperidine]
- 1′-Benzylspiro[3H-1-benzofuran-2,4′-piperidine]
- 2,3-Dihydro-1′-benzylspiro[benzofuran-2,4′-piperidine]
- 1′-Benzyl-3H-spiro[benzofuran-2,4′-piperidine]
- Spiro[benzofuran-2(3H),4′-piperidine], 1′-(phenylmethyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
1'-Benzyl-3H-spiro[benzofuran-2,4'-piperidine]
CAS:Formula:C19H21NOColor and Shape:SolidMolecular weight:279.3761

