CymitQuimica logo

CAS 71924-62-4

:

6-Fluoroveratraldehyde

Description:
6-Fluoroveratraldehyde is an organic compound characterized by the presence of a fluorine atom and an aldehyde functional group attached to a veratraldehyde backbone. Its molecular structure features a methoxy group on both the 3 and 4 positions of the aromatic ring, along with a fluorine substituent at the 6 position. This compound is typically a colorless to pale yellow liquid or solid, depending on its purity and form. It is known for its reactivity due to the aldehyde group, which can participate in various chemical reactions, including condensation and oxidation. The presence of the fluorine atom can influence its chemical properties, such as polarity and reactivity, making it useful in synthetic organic chemistry and potentially in pharmaceutical applications. Additionally, 6-Fluoroveratraldehyde may exhibit biological activity, although specific studies would be required to elucidate its pharmacological properties. As with all chemical substances, proper handling and safety precautions should be observed due to potential toxicity or reactivity.
Formula:C9H9FO3
InChI:InChI=1S/C9H9FO3/c1-12-8-3-6(5-11)7(10)4-9(8)13-2/h3-5H,1-2H3
InChI key:IBBYQNVXKFMSSI-UHFFFAOYSA-N
SMILES:COC1=C(C=C(C(=C1)C=O)F)OC
Synonyms:
  • 4,5-Dimethoxy-2-fluorobenzaldehyde
  • 2-Fluoro-4,5-dimethoxybenzaldehyde
Found 7 products.