CymitQuimica logo

CAS 719274-56-3

:

Methyl 4-[3-(4-fluorophenyl)-1,2,4-oxadiazol-5-yl]bicyclo[2.2.2]octane-1-carboxylate

Description:
Methyl 4-[3-(4-fluorophenyl)-1,2,4-oxadiazol-5-yl]bicyclo[2.2.2]octane-1-carboxylate is a chemical compound characterized by its complex bicyclic structure and the presence of an oxadiazole moiety. The compound features a bicyclo[2.2.2]octane framework, which contributes to its rigidity and potential biological activity. The incorporation of a 4-fluorophenyl group enhances its lipophilicity and may influence its interaction with biological targets. The oxadiazole ring is known for its role in various pharmacological activities, including antimicrobial and anti-inflammatory properties. As a methyl ester, the carboxylate group is likely to participate in esterification reactions, making the compound versatile for further chemical modifications. The presence of fluorine in the structure can also enhance metabolic stability and bioactivity. Overall, this compound's unique structural features suggest potential applications in medicinal chemistry, particularly in the development of novel therapeutic agents. However, specific biological activities and properties would require empirical investigation to fully understand its potential uses.
Formula:C18H19FN2O3
InChI:InChI=1S/C18H19FN2O3/c1-23-16(22)18-9-6-17(7-10-18,8-11-18)15-20-14(21-24-15)12-2-4-13(19)5-3-12/h2-5H,6-11H2,1H3
InChI key:InChIKey=OJXPYEFBBLDCHA-UHFFFAOYSA-N
SMILES:C(OC)(=O)C12CCC(CC1)(CC2)C3=NC(=NO3)C4=CC=C(F)C=C4
Synonyms:
  • Bicyclo[2.2.2]octane-1-carboxylic acid, 4-[3-(4-fluorophenyl)-1,2,4-oxadiazol-5-yl]-, methyl ester
  • Methyl 4-[3-(4-fluorophenyl)-1,2,4-oxadiazol-5-yl]bicyclo[2.2.2]octane-1-carboxylate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.