CAS 71942-06-8
:(7-hydroxy-8-methoxy-2-oxo-2H-chromen-6-yl)acetic acid
Description:
(7-hydroxy-8-methoxy-2-oxo-2H-chromen-6-yl)acetic acid, with the CAS number 71942-06-8, is a chemical compound belonging to the class of flavonoids, specifically a derivative of coumarin. This substance features a chromen-2-one backbone, characterized by a benzopyran structure, which is known for its diverse biological activities. The presence of hydroxyl and methoxy groups enhances its solubility and reactivity, contributing to its potential antioxidant and anti-inflammatory properties. The acetic acid moiety suggests that it may exhibit acidic behavior, which can influence its interaction with biological systems. This compound is of interest in medicinal chemistry due to its potential therapeutic applications, including anti-cancer and neuroprotective effects. Its structural features may also allow for various modifications, making it a candidate for further research in drug development. Overall, (7-hydroxy-8-methoxy-2-oxo-2H-chromen-6-yl)acetic acid represents a significant compound in the study of natural products and their pharmacological potential.
Formula:C12H10O6
InChI:InChI=1/C12H10O6/c1-17-12-10(16)7(5-8(13)14)4-6-2-3-9(15)18-11(6)12/h2-4,16H,5H2,1H3,(H,13,14)
SMILES:COc1c(c(cc2ccc(=O)oc12)CC(=O)O)O
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.