CAS 71942-14-8
:Phenol, 3-bromo-4,5-dimethyl-
Description:
Phenol, 3-bromo-4,5-dimethyl- is an organic compound characterized by a phenolic structure with specific substituents. It features a bromine atom at the meta position (3-position) and two methyl groups at the ortho (4-position) and para (5-position) positions relative to the hydroxyl group (-OH) on the benzene ring. This compound is typically a colorless to pale yellow solid or liquid, depending on its purity and form. It exhibits typical phenolic properties, including moderate solubility in water and higher solubility in organic solvents. The presence of the bromine atom introduces additional reactivity, making it useful in various chemical reactions, such as electrophilic substitution. The methyl groups contribute to the compound's hydrophobic character and can influence its biological activity and chemical reactivity. As with many brominated compounds, it may have implications for environmental and health safety, necessitating careful handling and disposal. Overall, 3-bromo-4,5-dimethylphenol is of interest in both synthetic organic chemistry and potential applications in pharmaceuticals or agrochemicals.
Formula:C8H9BrO
InChI:InChI=1S/C8H9BrO/c1-5-3-7(10)4-8(9)6(5)2/h3-4,10H,1-2H3
InChI key:GJVYZGLNIKGKTE-UHFFFAOYSA-N
SMILES:CC1=CC(=CC(=C1C)Br)O
Filter by
Purity percentage
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
3-Bromo-4,5-dimethylphenol
CAS:3-Bromo-4,5-dimethylphenolFormula:C8H9BrOPurity:97%Molecular weight:201.063-Bromo-4,5-dimethylphenol
CAS:Formula:C8H9BrOPurity:97%Color and Shape:SolidMolecular weight:201.06053-Bromo-4,5-dimethylphenol
CAS:3-Bromo-4,5-dimethylphenolFormula:C8H9BrOPurity:97%Molecular weight:201.063-Bromo-4,5-dimethylphenol
CAS:Formula:C8H9BrOPurity:97%Color and Shape:SolidMolecular weight:201.0633-Bromo-4,5-dimethylphenol
CAS:3-Bromo-4,5-dimethylphenol is a bromination product of the structurally related compound 4,5-dimethylphenol. The electrophilic character of 3-bromo-4,5-dimethylphenol is due to the bromine atom. It can be used as an intermediate for the synthesis of other chemicals. Bromination of 4,5-dimethylphenol takes place in two steps: first a nucleophilic attack by bromide ion on one of the carbon atoms in 4,5-dimethylphenol and then an electrophilic substitution reaction between the bromine atom and one of the hydroxyl groups. The mechanisms for these reactions are shown below:Formula:C8H9BrOPurity:Min. 95%Molecular weight:201.06 g/mol




