CAS 71942-38-6

3-oxo-3H-benzo[f]chromene-2-carbonyl chloride

Description:

3-Oxo-3H-benzo[f]chromene-2-carbonyl chloride, identified by its CAS number 71942-38-6, is a chemical compound that belongs to the class of chromenes, which are characterized by a fused benzene and pyran ring structure. This specific compound features a carbonyl chloride functional group, which makes it a reactive acyl chloride. Its structure includes a ketone group at the 3-position of the chromene ring, contributing to its reactivity and potential applications in organic synthesis. The presence of the carbonyl chloride group indicates that it can participate in nucleophilic acyl substitution reactions, making it useful for the synthesis of various derivatives. Additionally, compounds of this nature may exhibit biological activity, although specific biological properties would require further investigation. Overall, 3-oxo-3H-benzo[f]chromene-2-carbonyl chloride is notable for its structural complexity and potential utility in synthetic organic chemistry.

Formula: C₁₄H₇ClO₃

InChI: InChI=1/C14H7ClO3/c15-13(16)11-7-10-9-4-2-1-3-8(9)5-6-12(10)18-14(11)17/h1-7H

SMILES: c1ccc2c(c1)ccc1c2cc(C(=O)Cl)c(=O)o1

Synonyms:

• 3H-naphtho[2,1-b]pyran-2-carbonyl chloride, 3-oxo-