CAS 71950-66-8
:4-({4-[(2,4-dihydroxy-3,6-dimethylbenzoyl)oxy]-2-hydroxy-3,5,6-trimethylbenzoyl}oxy)-2-hydroxy-3,5,6-trimethylbenzoic acid
Description:
The chemical substance known as "4-({4-[(2,4-dihydroxy-3,6-dimethylbenzoyl)oxy]-2-hydroxy-3,5,6-trimethylbenzoyl}oxy)-2-hydroxy-3,5,6-trimethylbenzoic acid" with CAS number 71950-66-8 is a complex organic compound characterized by multiple hydroxyl and benzoyl functional groups. This structure suggests it may exhibit significant solubility in organic solvents and potential interactions with biological systems due to its multiple hydroxyl groups, which can engage in hydrogen bonding. The presence of multiple methyl groups indicates a degree of hydrophobicity, which may influence its overall solubility and reactivity. Additionally, the compound's intricate structure may confer specific properties such as antioxidant activity or UV absorption, making it potentially useful in cosmetic or pharmaceutical applications. Its molecular complexity also suggests that it may have specific stereochemical configurations that could affect its biological activity. Overall, this compound exemplifies the intricate interplay of functional groups in organic chemistry, leading to diverse potential applications.
Formula:C29H30O10
InChI:InChI=1/C29H30O10/c1-10-9-18(30)15(6)22(31)19(10)28(36)38-26-14(5)12(3)21(24(33)17(26)8)29(37)39-25-13(4)11(2)20(27(34)35)23(32)16(25)7/h9,30-33H,1-8H3,(H,34,35)
SMILES:Cc1cc(c(C)c(c1C(=O)Oc1c(C)c(C)c(c(c1C)O)C(=O)Oc1c(C)c(C)c(c(c1C)O)C(=O)O)O)O
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
Thielavin A
CAS:Thielavin A, from T. terricola, inhibits COX and glucose-6-phosphatase; non-competitive α-glucosidase inhibitor.Formula:C29H30O10Color and Shape:SolidMolecular weight:538.549

