CAS 71950-67-9
:4-Carboxy-3-methoxy-2,5,6-trimethylphenyl 4-[(2,4-dihydroxy-3,6-dimethylbenzoyl)oxy]-2-methoxy-3,5,6-trimethylbenzoate
Description:
4-Carboxy-3-methoxy-2,5,6-trimethylphenyl 4-[(2,4-dihydroxy-3,6-dimethylbenzoyl)oxy]-2-methoxy-3,5,6-trimethylbenzoate, with CAS number 71950-67-9, is a complex organic compound characterized by its intricate molecular structure, which includes multiple functional groups such as carboxylic acids, methoxy groups, and hydroxyl groups. This compound is likely to exhibit properties typical of phenolic compounds, including potential antioxidant activity due to the presence of hydroxyl groups. Its multiple methyl groups contribute to its hydrophobic character, which may influence its solubility in organic solvents. The presence of ester linkages suggests that it may participate in hydrolysis reactions under certain conditions. Additionally, the compound's structure indicates potential applications in pharmaceuticals or agrochemicals, where such derivatives are often explored for their biological activities. Overall, the compound's unique arrangement of substituents may confer specific reactivity and interaction profiles, making it a subject of interest in chemical research and development.
Formula:C31H34O10
InChI:InChI=1/C31H34O10/c1-12-11-20(32)17(6)24(33)21(12)30(36)40-26-16(5)14(3)23(28(39-10)19(26)8)31(37)41-25-15(4)13(2)22(29(34)35)27(38-9)18(25)7/h11,32-33H,1-10H3,(H,34,35)
InChI key:InChIKey=UULGWGARYDGVBM-UHFFFAOYSA-N
SMILES:C(OC1=C(C)C(OC)=C(C(O)=O)C(C)=C1C)(=O)C2=C(OC)C(C)=C(OC(=O)C3=C(O)C(C)=C(O)C=C3C)C(C)=C2C
Synonyms:- 4-Carboxy-3-methoxy-2,5,6-trimethylphenyl 4-[(2,4-dihydroxy-3,6-dimethylbenzoyl)oxy]-2-methoxy-3,5,6-trimethylbenzoate
- Thielavin B
- Benzoic acid, 4-[(2,4-dihydroxy-3,6-dimethylbenzoyl)oxy]-2-methoxy-3,5,6-trimethyl-, 4-carboxy-3-methoxy-2,5,6-trimethylphenyl ester
- 4-[(2,4-Dihydroxy-3,6-dimethylbenzoyl)oxy]-2-methoxy-3,5,6-trimethylbenzoic acid 4-carboxy-3-methoxy-2,5,6-trimethylphenyl ester
- See more synonyms
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
Thielavin B
CAS:<p>Thielavin B, from Thielavia terricola, inhibits prostaglandin E2 synthesis and reduces rat oedema.</p>Formula:C31H34O10Color and Shape:SolidMolecular weight:566.6

