CAS 71953-77-0

Leiocarposide

Description:

Leiocarposide, with the CAS number 71953-77-0, is a chemical compound that belongs to the class of glycosides. It is derived from natural sources, often associated with specific plant species. The compound typically exhibits a complex structure characterized by a sugar moiety linked to a non-sugar aglycone, which contributes to its biological activity. Leiocarposide is known for its potential pharmacological properties, including antioxidant and anti-inflammatory effects, making it of interest in medicinal chemistry and natural product research. Its solubility and stability can vary depending on the solvent and environmental conditions, which is crucial for its application in various fields, including pharmaceuticals and nutraceuticals. Additionally, studies on Leiocarposide may explore its mechanisms of action, potential therapeutic uses, and interactions with biological systems. As with many natural compounds, further research is essential to fully understand its properties and potential applications.

Formula: C₂₇H₃₄O₁₆

InChI: InChI=1/C27H34O16/c1-38-24-14(41-27-23(36)21(34)19(32)16(9-29)43-27)7-6-12(30)17(24)25(37)39-10-11-4-2-3-5-13(11)40-26-22(35)20(33)18(31)15(8-28)42-26/h2-7,15-16,18-23,26-36H,8-10H2,1H3/t15-,16-,18-,19-,20+,21+,22-,23-,26-,27-/m1/s1

InChI key: InChIKey=WQQJTVODGXZMHF-WRXRYXBBSA-N

SMILES: O(C1=C(OC)C(C(OCC2=C(O[C@@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)C=CC=C2)=O)=C(O)C=C1)[C@@H]4O[C@H](CO)[C@@H](O)[C@H](O)[C@H]4O

Synonyms:

• Leiocarposide
• 2-[[[3-(β-D-Glucopyranosyloxy)-6-hydroxy-2-methoxybenzoyl]oxy]methyl]phenyl β-D-glucopyranoside
• β-D-Glucopyranoside, 2-[[[3-(β-D-glucopyranosyloxy)-6-hydroxy-2-methoxybenzoyl]oxy]methyl]phenyl
• nzoyl)oxy)methyl)phenyl-
• beta-d-glucopyranoside,2-(((4-(beta-d-glucopyranosyloxy)-2-hydroxy-3-methoxybe
• 2-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]methyl 6-hydroxy-2-methoxy-3-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxybenzoate
• 2’-hydroxybenzyl-3-methoxybenzoate2’,4-diglucoside
• lejokarpozyd

Leiocarposide

CAS: 71953-77-0

Leiocarposide is a phenolic bisglucoside from Solidago virgaurea L.

Formula: C₂₇H₃₄O₁₆

Color and Shape: Less Solid Colourless Solid

Molecular weight: 614.55

Ref: TM-T32625

Leiocarposide

CAS: 71953-77-0

Formula: C₂₇H₃₄O₁₆

Purity: 95%~99%

Molecular weight: 614.553

Ref: BP-BP0849

Leiocarposide

CAS: 71953-77-0

Natural glycoside

Formula: C₂₇H₃₄O₁₆

Purity: ≥ 95.0 % (HPLC)

Color and Shape: Powder

Molecular weight: 614.56

Ref: 5G-89241

Leiocarposide(aS)

CAS: 71953-77-0

**Leiocarposide (aS)** is a natural product, which is a glycoside compound isolated from the plant genus Homalolepis. This compound is primarily sourced from natural extracts, specifically from plants known for their chemical diversity and potential pharmacological properties.

Formula: C₂₇H₃₄O₁₆

Purity: Min. 95%

Molecular weight: 614.55 g/mol

Ref: 3D-WCA95377