CAS 7196-71-6
:Ferulic acid glucoside
Description:
Ferulic acid glucoside is a naturally occurring compound derived from ferulic acid, a phenolic compound found in various plants. It is characterized by its glucoside structure, which means it consists of a glucose molecule linked to ferulic acid. This compound exhibits antioxidant properties, making it significant in both food and cosmetic applications, as it can help protect cells from oxidative stress. Ferulic acid glucoside is also known for its potential anti-inflammatory and skin-protective effects, contributing to its popularity in skincare formulations. In terms of solubility, it is generally soluble in water and organic solvents, which enhances its bioavailability. The compound is often studied for its role in promoting skin health and its potential benefits in preventing skin aging. Additionally, it may play a role in enhancing the stability and efficacy of other active ingredients in formulations. Overall, ferulic acid glucoside is valued for its multifunctional properties in both health and cosmetic industries.
Formula:C16H20O9
InChI:InChI=1S/C16H20O9/c1-23-10-6-8(2-4-9(10)18)3-5-12(19)25-16-15(22)14(21)13(20)11(7-17)24-16/h2-6,11,13-18,20-22H,7H2,1H3/t11-,13-,14+,15-,16+/m1/s1
InChI key:InChIKey=JWRQVQWBNRGGPK-JZYAIQKZSA-N
SMILES:O(C(C=CC1=CC(OC)=C(O)C=C1)=O)[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O
Synonyms:- Glucopyranose, 1-(4-hydroxy-3-methoxycinnamate)
- β-D-Glucopyranose, 1-[3-(4-hydroxy-3-methoxyphenyl)-2-propenoate]
- Feruloylglucose
- Glucopyranose, 1-(4-hydroxy-3-methoxycinnamate), β-D-
- Cinnamic acid, 4-hydroxy-3-methoxy-, β-D-glucopyranosyl ester
- 1-[3-(4-Hydroxy-3-Methoxyphenyl)-2-propenoate] β-D-Glucopyranose
- 4'-hydroxy-3'-methoxycinnamoyl-β-D-glucopyranose
- Ferulic Acid Acyl-b-D-glucoside
- Ferulic Acid Acyl-β-D-glucoside
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
1-[3-(4-Hydroxy-3-Methoxyphenyl)-2-propenoate] β-D-Glucopyranose
CAS:Formula:C16H20O9Purity:95%Color and Shape:SolidMolecular weight:356.3246(2S,3R,4S,5S,6R)-3,4,5-Trihydroxy-6-(hydroxymethyl)tetrahydro-2H-pyran-2-yl 3-(4-hydroxy-3-methoxyphenyl)acrylate
CAS:(2S,3R,4S,5S,6R)-3,4,5-Trihydroxy-6-(hydroxymethyl)tetrahydro-2H-pyran-2-yl 3-(4-hydroxy-3-methoxyphenyl)acrylatePurity:98%Molecular weight:356.33g/molFerulic acid acyl-β-D-glucoside
CAS:Ferulic acid acyl-β-D-glucoside, a metabolite of Ferulic Acid, is a novel inhibitor of fibroblast growth factor receptor 1 (FGFR1).Formula:C16H20O9Color and Shape:SolidMolecular weight:356.327Ferulic Acid Acyl-β-D-glucoside
CAS:Controlled ProductFormula:C16H20O9Color and Shape:NeatMolecular weight:356.32Ferulic acid acyl-b-D-glucoside
CAS:Ferulic acid acyl-b-D-glucoside is a flavonoid compound that has been shown to have antioxidant properties. It is found in plants and can be synthesized by the enzyme phenylalanine ammonia-lyase. Ferulic acid acyl-b-D-glucoside is insoluble in water, but soluble in organic solvents such as ethanol and acetone. The chemical composition of ferulic acid acyl-b-D-glucoside is not well understood, but it has been shown to contain chalcone, chlorogenic acids, aldehydes, celosianin, and betanidin.Purity:Min. 95%





