CAS 7196-94-3

[3-oxo-6-(trifluoromethyl)-3,4-dihydro-2H-1,4-benzothiazin-2-yl]acetic acid

Description:

[3-oxo-6-(trifluoromethyl)-3,4-dihydro-2H-1,4-benzothiazin-2-yl]acetic acid, with the CAS number 7196-94-3, is a chemical compound that belongs to the class of benzothiazine derivatives. This substance features a benzothiazine core, characterized by a fused benzene and thiazine ring, which contributes to its unique chemical properties. The presence of a trifluoromethyl group enhances its lipophilicity and may influence its biological activity. The keto group (3-oxo) and the acetic acid moiety suggest potential reactivity, making it a candidate for various chemical transformations. This compound may exhibit interesting pharmacological properties, potentially acting as an intermediate in the synthesis of pharmaceuticals or agrochemicals. Its structural features may also confer specific interactions with biological targets, warranting further investigation into its applications in medicinal chemistry. As with many chemical substances, safety data and handling precautions should be considered, as the trifluoromethyl group can impart toxicity and environmental concerns.

Formula: C₁₁H₈F₃NO₃S

InChI: InChI=1/C11H8F3NO3S/c12-11(13,14)5-1-2-7-6(3-5)15-10(18)8(19-7)4-9(16)17/h1-3,8H,4H2,(H,15,18)(H,16,17)

SMILES: c1cc2c(cc1C(F)(F)F)N=C(C(CC(=O)O)S2)O