CAS 71962-66-8

(2R)-hydroxy(3-phenoxyphenyl)ethanenitrile

Description:

(2R)-hydroxy(3-phenoxyphenyl)ethanenitrile, with the CAS number 71962-66-8, is a chemical compound characterized by its specific stereochemistry and functional groups. It features a hydroxyl group (-OH) attached to a chiral carbon, which contributes to its potential biological activity. The presence of a phenoxy group indicates that it has an aromatic structure, which can influence its solubility and reactivity. The nitrile group (-C≡N) is notable for its ability to participate in various chemical reactions, including nucleophilic additions and hydrolysis. This compound may exhibit properties typical of both phenolic compounds and nitriles, such as potential antioxidant activity or involvement in synthetic pathways. Its stereochemistry may also affect its interaction with biological targets, making it of interest in medicinal chemistry. Overall, (2R)-hydroxy(3-phenoxyphenyl)ethanenitrile is a compound that could have applications in pharmaceuticals or agrochemicals, depending on its specific biological properties and reactivity.

Formula: C₁₄H₁₁NO₂

InChI: InChI=1/C14H11NO2/c15-10-14(16)11-5-4-8-13(9-11)17-12-6-2-1-3-7-12/h1-9,14,16H/t14-/m0/s1

SMILES: c1ccc(cc1)Oc1cccc(c1)[C@H](C#N)O

Synonyms:

• Benzeneacetonitrile, alpha-hydroxy-3-phenoxy-, (alphaR)-