
CAS 71962-74-8
:Ethyl nipecotate
Description:
Ethyl nipecotate, with the CAS number 71962-74-8, is an organic compound classified as an ester. It is derived from nipecotic acid and ethanol, featuring a nipecotic acid backbone with an ethyl group attached. This compound is typically a colorless to pale yellow liquid with a characteristic odor. Ethyl nipecotate is known for its potential applications in the pharmaceutical industry, particularly as a precursor in the synthesis of various bioactive compounds. It exhibits moderate solubility in organic solvents and limited solubility in water, which is common for many esters. The compound's structure includes a cyclic amine, contributing to its unique chemical properties and reactivity. Ethyl nipecotate may also display biological activity, making it of interest in medicinal chemistry. As with many chemical substances, handling should be done with care, following appropriate safety guidelines to mitigate any potential hazards associated with its use.
Formula:C8H15NO2
InChI:InChI=1S/C8H15NO2/c1-2-11-8(10)7-4-3-5-9-6-7/h7,9H,2-6H2,1H3
InChI key:InChIKey=XIWBSOUNZWSFKU-UHFFFAOYSA-N
SMILES:C(OCC)(=O)C1CCCNC1
Synonyms:- Ethyl 3-piperidinecarboxylate
- 3-Piperidinecarboxylic acid, ethyl ester
- Ethyl nipecotate
- Nipecotic acid, ethyl ester
- 3-(Ethoxycarbonyl)piperidine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.