CAS 71964-75-5

2-[(6-methoxynaphthalen-2-yl)carbonyl]benzoic acid

Description:

2-[(6-Methoxynaphthalen-2-yl)carbonyl]benzoic acid, with the CAS number 71964-75-5, is an organic compound characterized by its complex structure that includes a benzoic acid moiety and a methoxynaphthalene group. This compound typically exhibits properties associated with aromatic compounds, such as stability and potential for π-π stacking interactions due to its conjugated system. The presence of the methoxy group enhances its solubility in organic solvents and may influence its reactivity and interaction with biological systems. As a carboxylic acid, it can participate in acid-base reactions and may form salts or esters. The compound's unique structure suggests potential applications in pharmaceuticals or as a chemical intermediate, particularly in the synthesis of more complex organic molecules. Its specific characteristics, such as melting point, boiling point, and solubility, would depend on the purity and specific conditions of the environment in which it is studied. Overall, this compound represents a fascinating example of functionalized aromatic chemistry.

Formula: C₁₉H₁₄O₄

InChI: InChI=1/C19H14O4/c1-23-15-9-8-12-10-14(7-6-13(12)11-15)18(20)16-4-2-3-5-17(16)19(21)22/h2-11H,1H3,(H,21,22)

SMILES: COc1ccc2cc(ccc2c1)C(=O)c1ccccc1C(=O)O

2-[(6-Methoxy-2-naphthalenyl)carbonyl]benzoic Acid

Controlled Product

CAS: 71964-75-5

Applications 2-[(6-Methoxy-2-naphthalenyl)carbonyl]benzoic Acid is an intermediate in the synthesis of Benz[a]anthracen-3-ol (B120585), a derivative of the most potent carcinogenic hydrocarbon, 7,12-Dimethylbenz[a]anthracene (D464500).
References Lee, H.M., et al.: J. Org. Chem., 44, 4948 (1979); Harvey, R.G.,et al.: J. Med. Chem., 31, 154 (1988);

Formula: C₁₉H₁₄O₄

Color and Shape: Neat

Molecular weight: 306.31

Ref: TR-M260995