CAS 71965-22-5
:1,2,3,6-Tetrahydro-2,6-dioxo-9H-purine-9-carboxylic acid
Description:
1,2,3,6-Tetrahydro-2,6-dioxo-9H-purine-9-carboxylic acid, also known by its CAS number 71965-22-5, is a purine derivative characterized by its bicyclic structure, which includes a fused imidazole and pyrimidine ring. This compound features two carbonyl groups (dioxo) and a carboxylic acid functional group, contributing to its acidic properties. It is typically a white to off-white solid and is soluble in polar solvents, such as water and alcohols, due to the presence of polar functional groups. The compound is of interest in biochemical research, particularly in studies related to nucleic acids and metabolic pathways involving purines. Its structural features may influence its biological activity, making it a potential candidate for further pharmacological investigation. Additionally, its stability and reactivity can be influenced by environmental factors such as pH and temperature, which are important considerations in experimental applications.
Formula:C6H4N4O4
InChI:InChI=1S/C6H4N4O4/c11-4-2-3(8-5(12)9-4)10(1-7-2)6(13)14/h1H,(H,13,14)(H2,8,9,11,12)
InChI key:InChIKey=WKBPMGCUQROFFD-UHFFFAOYSA-N
SMILES:C(O)(=O)N1C2=C(N=C1)C(=O)NC(=O)N2
Synonyms:- 1,2,3,6-Tetrahydro-2,6-dioxo-9H-purine-9-carboxylic acid
- 9H-Purine-9-carboxylic acid, 1,2,3,6-tetrahydro-2,6-dioxo-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
