CAS 7197-01-5

6-chloro-3-methyl[1,2,4]triazolo[4,3-b]pyridazine

Description:

6-Chloro-3-methyl[1,2,4]triazolo[4,3-b]pyridazine is a heterocyclic compound characterized by its unique triazole and pyridazine ring structures. This compound features a chlorine atom at the 6-position and a methyl group at the 3-position of the triazole moiety, contributing to its chemical reactivity and potential biological activity. It is typically a solid at room temperature and may exhibit moderate solubility in polar organic solvents. The presence of the triazole ring suggests potential applications in pharmaceuticals, particularly in the development of antimicrobial or antifungal agents, due to the biological significance of triazole derivatives. Additionally, the chlorine substituent can enhance lipophilicity and influence the compound's interaction with biological targets. As with many heterocycles, the compound's stability and reactivity can be influenced by environmental factors such as pH and temperature. Overall, 6-chloro-3-methyl[1,2,4]triazolo[4,3-b]pyridazine represents a class of compounds with diverse applications in medicinal chemistry and material science.

Formula: C₆H₅ClN₄

InChI: InChI=1/C6H5ClN4/c1-4-8-9-6-3-2-5(7)10-11(4)6/h2-3H,1H3

SMILES: Cc1nnc2ccc(Cl)nn12

Synonyms:

• 1,2,4-Triazolo[4,3-b]pyridazine, 6-chloro-3-methyl-
• 6-Chloro-3-methyl[1,2,4]triazolo[4,3-b]pyridazine

6-Chloro-3-methyl[1,2,4]triazolo[4,3-b]pyridazine

CAS: 7197-01-5

Formula: C₆H₅ClN₄

Purity: 97%

Color and Shape: Solid

Molecular weight: 168.5837

Ref: IN-DA00FAL0

6-Chloro-3-methyl[1,2,4]triazolo[4,3-b]pyridazine

CAS: 7197-01-5

6-Chloro-3-methyl[1,2,4]triazolo[4,3-b]pyridazine

Purity: 99%

Molecular weight: 168.58g/mol

Ref: 54-OR953373

6-Chloro-3-methyl-[1,2,4]triazolo[4,3-b]pyridazine

CAS: 7197-01-5

Formula: C₆H₅ClN₄

Purity: 97%

Color and Shape: Solid

Molecular weight: 168.58

Ref: 10-F209497