CAS 7197-96-8

6,7,8,9-Tetrahydro-5H-cyclohepta[b]pyridine

Description:

6,7,8,9-Tetrahydro-5H-cyclohepta[b]pyridine, with the CAS number 7197-96-8, is a bicyclic organic compound characterized by its unique structure that includes a saturated cycloheptane ring fused to a pyridine ring. This compound is typically colorless to pale yellow and exhibits a relatively low molecular weight. It is known for its potential applications in medicinal chemistry, particularly as a building block for various pharmaceuticals due to its ability to interact with biological systems. The presence of nitrogen in the pyridine ring contributes to its basicity and reactivity, allowing for various chemical modifications. Additionally, the compound's saturated nature may influence its solubility and stability in different solvents. Its properties, such as boiling point and melting point, can vary based on purity and environmental conditions. Overall, 6,7,8,9-Tetrahydro-5H-cyclohepta[b]pyridine is of interest in research for its structural features and potential biological activity.

Formula: C₁₀H₁₃N

InChI: InChI=1S/C10H13N/c1-2-5-9-6-4-8-11-10(9)7-3-1/h4,6,8H,1-3,5,7H2

InChI key: InChIKey=CULUYAUTCSKQNM-UHFFFAOYSA-N

SMILES: C=12C(=NC=CC1)CCCCC2

Synonyms:

• 5H-Cyclohepta[b]pyridine, 6,7,8,9-tetrahydro-
• 2,3-Cycloheptenopyridine
• 6,7,8,9-Tetrahydro-5H-cyclohepta[b]pyridine

2,3-Cycloheptenopyridine

CAS: 7197-96-8

Formula: C₁₀H₁₃N

Purity: 95%

Color and Shape: Liquid

Molecular weight: 147.2169

Ref: IN-DA003FGG

2,3-Cycloheptenopyridine

CAS: 7197-96-8

2,3-Cycloheptenopyridine

Purity: 95%

Molecular weight: 147.22g/mol

Ref: 54-OR1052305

6,7,8,9-TETRAHYDRO-5H-CYCLOHEPTA[B]PYRIDINE

CAS: 7197-96-8

Purity: 95%

Molecular weight: 147.220993

Ref: 10-F832391

2,3-Cycloheptenopyridine

CAS: 7197-96-8

2,3-Cycloheptenopyridine is a molybdenum metal complex with chloroform. It belongs to the class of nucleophilic complexes. The reaction product of cycloheptenopyridine n-oxide and formaldehyde, it has a spectrum that shows peaks at 521 nm and 609 nm. This complex can be prepared by reacting 2,3-cycloheptenopyridine with hydrogen peroxide in dimethylformamide as a reagent.
2,3-Cycloheptenopyridine is an example of an n-oxide because it contains both oxygen atoms in the same molecule. The two isomers are cis and trans, but only the cis form is known to exist naturally on Earth. The trans isomer can be synthesized through the use of peroxides or trioxides; however, this synthetic form is only stable at temperatures above 300°C.

Formula: C₁₀H₁₃N

Purity: Min. 95%

Molecular weight: 147.22 g/mol

Ref: 3D-HAA19796