CymitQuimica logo

CAS 71989-17-8

:

Fmoc-Asn-ONp

Description:
Fmoc-Asn-ONp, or 9-fluorenylmethoxycarbonyl asparagine p-nitrophenyl ester, is a chemical compound commonly used in peptide synthesis and biochemistry. It features the Fmoc (9-fluorenylmethoxycarbonyl) protecting group, which is widely utilized to protect amino groups during the synthesis of peptides. The asparagine (Asn) residue is an amino acid that contains an amide side chain, contributing to the compound's properties. The p-nitrophenyl (ONp) moiety serves as a leaving group, making it useful in coupling reactions where the release of the nitrophenol can be monitored spectrophotometrically. Fmoc-Asn-ONp is typically a white to off-white solid and is soluble in organic solvents such as dimethylformamide (DMF) and dimethyl sulfoxide (DMSO). Its stability under standard laboratory conditions allows for its use in various synthetic protocols. Overall, Fmoc-Asn-ONp is a valuable reagent in the field of peptide chemistry, facilitating the formation of peptide bonds while providing a means for selective deprotection.
Formula:C25H21N3O7
InChI:InChI=1/C25H21N3O7/c26-23(29)13-22(24(30)35-16-11-9-15(10-12-16)28(32)33)27-25(31)34-14-21-19-7-3-1-5-17(19)18-6-2-4-8-20(18)21/h1-12,21-22H,13-14H2,(H2,26,29)(H,27,31)
SMILES:c1ccc2c(c1)c1ccccc1C2COC(=NC(CC(=N)O)C(=O)Oc1ccc(cc1)N(=O)=O)O
Synonyms:
  • 4-nitrophenyl N~2~-[(9H-fluoren-9-ylmethoxy)carbonyl]asparaginate
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.