CAS 71989-25-8
:Fmoc-Leu-ONp
Description:
Fmoc-Leu-ONp, or 9-fluorenylmethoxycarbonyl-L-leucine p-nitrophenyl ester, is a chemical compound commonly used in peptide synthesis as a protecting group for amino acids. The Fmoc group provides stability during the synthesis process and can be easily removed under basic conditions, allowing for the selective deprotection of the amino acid. The leucine component contributes hydrophobic characteristics, which can influence the solubility and folding of peptides. The p-nitrophenyl ester (ONp) moiety serves as a leaving group during the coupling reactions, facilitating the formation of peptide bonds. This compound is typically a white to off-white solid and is soluble in organic solvents such as dimethylformamide (DMF) and dichloromethane (DCM). Its use is prevalent in solid-phase peptide synthesis (SPPS), where it aids in the efficient assembly of peptides. Safety precautions should be observed when handling this compound, as it may pose health risks if ingested or inhaled.
Formula:C27H26N2O6
InChI:InChI=1/C27H26N2O6/c1-17(2)15-25(26(30)35-19-13-11-18(12-14-19)29(32)33)28-27(31)34-16-24-22-9-5-3-7-20(22)21-8-4-6-10-23(21)24/h3-14,17,24-25H,15-16H2,1-2H3,(H,28,31)
SMILES:CC(C)CC(C(=O)Oc1ccc(cc1)N(=O)=O)N=C(O)OCC1c2ccccc2c2ccccc12
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
