CymitQuimica logo

CAS 71989-32-7

:

1-(9H-Fluoren-9-ylmethyl) 2-(4-nitrophenyl) (2S)-1,2-pyrrolidinedicarboxylate

Description:
1-(9H-Fluoren-9-ylmethyl) 2-(4-nitrophenyl) (2S)-1,2-pyrrolidinedicarboxylate is a chemical compound characterized by its complex structure, which includes a pyrrolidine ring and functional groups such as a nitrophenyl moiety and a fluorenylmethyl group. This compound typically exhibits properties associated with both aromatic and aliphatic systems, contributing to its potential reactivity and stability. The presence of the nitro group suggests it may have electron-withdrawing characteristics, influencing its reactivity in various chemical reactions. The fluorenylmethyl group can provide steric hindrance, which may affect the compound's interactions with other molecules. Additionally, the pyrrolidine ring contributes to the compound's overall three-dimensional conformation, which can be crucial for biological activity or interaction with enzymes and receptors. This compound may be of interest in medicinal chemistry and materials science due to its unique structural features and potential applications in drug development or as a synthetic intermediate. However, specific physical properties such as solubility, melting point, and spectral data would require experimental determination or literature reference for precise characterization.
Formula:C26H22N2O6
InChI:InChI=1S/C26H22N2O6/c29-25(34-18-13-11-17(12-14-18)28(31)32)24-10-5-15-27(24)26(30)33-16-23-21-8-3-1-6-19(21)20-7-2-4-9-22(20)23/h1-4,6-9,11-14,23-24H,5,10,15-16H2/t24-/m0/s1
InChI key:InChIKey=DPQKQTHUEOUIMN-DEOSSOPVSA-N
SMILES:C(OC(=O)N1[C@H](C(OC2=CC=C(N(=O)=O)C=C2)=O)CCC1)C3C=4C(C=5C3=CC=CC5)=CC=CC4
Synonyms:
  • 1-(9H-Fluoren-9-ylmethyl) 2-(4-nitrophenyl) (2S)-1,2-pyrrolidinedicarboxylate
  • 1-O-(9H-Fluoren-9-ylmethyl) 2-O-(4-nitrophenyl) (2S)-pyrrolidine-1,2-dicarboxylate
  • 1,2-Pyrrolidinedicarboxylic acid, 1-(9H-fluoren-9-ylmethyl) 2-(4-nitrophenyl) ester, (2S)-
  • 1,2-Pyrrolidinedicarboxylic acid, 1-(9H-fluoren-9-ylmethyl) 2-(4-nitrophenyl) ester, (S)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.