CAS 71989-93-0
:2,4,6-Trihydroxybenzoic acid monohydrate
Description:
2,4,6-Trihydroxybenzoic acid monohydrate is an organic compound characterized by its three hydroxyl (-OH) groups attached to a benzene ring, specifically at the 2, 4, and 6 positions relative to the carboxylic acid (-COOH) group. This structure contributes to its acidic properties and potential for hydrogen bonding, enhancing its solubility in polar solvents like water. The monohydrate form indicates the presence of one water molecule associated with each molecule of the acid, which can influence its physical properties, such as melting point and stability. This compound is often studied for its antioxidant properties and potential applications in pharmaceuticals and cosmetics due to its ability to scavenge free radicals. Additionally, its structural features may allow it to participate in various chemical reactions, making it a valuable intermediate in organic synthesis. Overall, 2,4,6-Trihydroxybenzoic acid monohydrate is notable for its multifunctional characteristics, which are of interest in both research and industrial applications.
Formula:C7H5O5
InChI:InChI=1/C7H6O5/c8-3-1-4(9)6(7(11)12)5(10)2-3/h1-2,8-10H,(H,11,12)/p-1
SMILES:c1c(cc(c(c1O)C(=O)O)O)[O-]
Synonyms:- 2,4,6-Trihydroxybenzoic Acid Hydrate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
2,4,6-Trihydroxybenzoic Acid Monohydrate
CAS:Formula:C7H6O5·H2OPurity:>95.0%(T)Color and Shape:White to Light yellow to Light orange powder to crystalMolecular weight:188.142,4,6-Trihydroxybenzoic acid monohydrate, 90+%
CAS:2,4,6-Trihydroxybenzoic acid monohydrate is an important raw material and intermediate used in organic synthesis, pharmaceuticals, agrochemicals and dyestuff fields. This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label i
Formula:C7H5O5Purity:90+%Color and Shape:White to pale cream to pale yellow, PowderMolecular weight:169.112,4,6-Trihydroxybenzoic acid hydrate
CAS:Formula:C7H8O6Purity:98%Color and Shape:SolidMolecular weight:188.13482,4,6-Trihydroxybenzoic Acid Monohydrate
CAS:2,4,6-Trihydroxybenzoic Acid MonohydratePurity:95%Molecular weight:188.13g/mol2,4,6-Trihydroxybenzoic acid hydrate
CAS:Formula:C7H8O6Purity:95%Color and Shape:Solid, Crystalline Powder or PowderMolecular weight:188.135




