CAS 71989-96-3
:2,3,4-trimethoxybenzyl alcohol
Description:
2,3,4-Trimethoxybenzyl alcohol is an organic compound characterized by its aromatic structure, which includes a benzene ring substituted with three methoxy groups (-OCH3) at the 2, 3, and 4 positions, along with a hydroxymethyl group (-CH2OH) at the benzyl position. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its form and purity. It is soluble in organic solvents such as ethanol and ether, but its solubility in water is limited due to the hydrophobic nature of the aromatic ring. The presence of multiple methoxy groups enhances its electron-donating properties, which can influence its reactivity and interactions in various chemical environments. 2,3,4-Trimethoxybenzyl alcohol may exhibit biological activity, making it of interest in medicinal chemistry and pharmacology. Its synthesis often involves the methylation of a suitable precursor followed by reduction to yield the alcohol. As with many organic compounds, proper handling and safety precautions are essential due to potential toxicity or reactivity.
Formula:C10H14O4
InChI:InChI=1/C10H14O4/c1-12-8-5-4-7(6-11)9(13-2)10(8)14-3/h4-5,11H,6H2,1-3H3
InChI key:InChIKey=DGJVVEVPKPOLEV-UHFFFAOYSA-N
SMILES:O(C)C1=C(OC)C(OC)=CC=C1CO
Synonyms:- (2,3,4-Trimethoxyphenyl)methanol
- 1-Hydroxymethyl-2,3,4-trimethoxybenzene
- 2,3,4-Trimethoxybenzene methanol
- 2,3,4-Trimethoxybenzenemethanol
- Benzenemethanol, 2,3,4-trimethoxy-
- 2,3,4-Trimethoxybenzyl alcohol
- Benzyl alcohol, 2,3,4-trimethoxy-
- RARECHEM AL BD 0024
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 10 products.
TriMetazidine EP IMpurity-D
CAS:<p>TriMetazidine EP Impurity-D is the starting material for the synthesis of TriMetazidine and an intermediate for the synthesis of various compounds.</p>Formula:C10H14O4Purity:99.59%Color and Shape:SolidMolecular weight:198.22(2,3,4-Trimethoxyphenyl)methanol
CAS:Formula:C10H14O4Purity:95%Color and Shape:LiquidMolecular weight:198.21582,3,4-Trimethoxybenzyl Alcohol
CAS:2,3,4-Trimethoxybenzyl AlcoholPurity:97%Molecular weight:198.22g/molTrimetazidine EP Impurity D
CAS:Formula:C10H14O4Color and Shape:Colorless LiquidMolecular weight:198.22(2,3,4-Trimethoxyphenyl)methanol
CAS:Controlled ProductFormula:C10H14O4Color and Shape:NeatMolecular weight:198.222,3,4-Trimethoxybenzyl Alcohol
CAS:Controlled Product<p>Impurity Trimetazidine EP impurity D<br>Applications 2,3,4-Trimethoxybenzyl Alcohol is a trimethoxylated aromatic alcohol. 2,3,4-Trimethoxybenzyl Alcohol is an impurity of the anti-anginal drug Trimetazidine (T795610).<br>References Medenica, M.B. et al.: J. Chrom. Sci., 46, 430 (2008);<br></p>Formula:C10H14O4Color and Shape:Clear Colourless To Light YellowMolecular weight:198.222,3,4-Trimethoxybenzyl alcohol
CAS:2,3,4-Trimethoxybenzyl alcohol is a photooxidant that is used in pharmaceutical formulations. It has a catalytic effect on the photooxidation of trifluoroacetic acid and is used for the production of fluoroquinolones. It can also be used to produce other pharmaceutical compounds such as antibiotics and anti-cancer drugs. 2,3,4-Trimethoxybenzyl alcohol is found in small quantities in many natural products such as fruits and vegetables. It has been shown to have potential impurities including 4-methoxybenzaldehyde and selectivity modifiers.Formula:C10H14O4Purity:Min 96.5%Color and Shape:Clear LiquidMolecular weight:198.22 g/mol2,3,4-Trimethoxybenzyl alcohol
CAS:Formula:C10H14O4Purity:95%Color and Shape:LiquidMolecular weight:198.218








