
CAS 71989-99-6
:2,3,4-Trimethoxy-α-methylbenzeneacetic acid
Description:
2,3,4-Trimethoxy-α-methylbenzeneacetic acid, with the CAS number 71989-99-6, is an organic compound characterized by its aromatic structure and multiple methoxy groups. This compound features a benzene ring substituted with three methoxy groups at the 2, 3, and 4 positions, along with an α-methyl group and a carboxylic acid functional group. The presence of methoxy groups enhances its solubility in organic solvents and may influence its reactivity and biological activity. The carboxylic acid group contributes to its acidity and potential for forming salts or esters. This compound may exhibit interesting pharmacological properties, making it of interest in medicinal chemistry. Its structural features suggest potential applications in various fields, including pharmaceuticals and agrochemicals. However, specific data regarding its physical properties, such as melting point, boiling point, and solubility, would require further investigation or reference to specialized chemical databases. Overall, 2,3,4-Trimethoxy-α-methylbenzeneacetic acid represents a complex organic molecule with potential utility in various chemical applications.
Formula:C12H16O5
InChI:InChI=1S/C12H16O5/c1-7(12(13)14)8-5-6-9(15-2)11(17-4)10(8)16-3/h5-7H,1-4H3,(H,13,14)
InChI key:InChIKey=YAURVMGBGYEPTE-UHFFFAOYSA-N
SMILES:O(C)C1=C(C(C(O)=O)C)C=CC(OC)=C1OC
Synonyms:- 2,3,4-Trimethoxy-α-methylbenzeneacetic acid
- Benzeneacetic acid, 2,3,4-trimethoxy-α-methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.