CAS 71995-54-5
:(cyclohexyloxy)acetic acid
Description:
(cyclohexyloxy)acetic acid, with the CAS number 71995-54-5, is an organic compound characterized by its cyclohexyl group attached to an ether functional group and a carboxylic acid. This compound typically appears as a colorless to pale yellow liquid and is soluble in organic solvents, while its solubility in water may vary depending on conditions. The presence of the cyclohexyl moiety contributes to its hydrophobic characteristics, while the carboxylic acid group provides acidic properties, allowing it to participate in various chemical reactions, such as esterification and neutralization. (cyclohexyloxy)acetic acid is often studied for its potential applications in pharmaceuticals, agrochemicals, and as a chemical intermediate. Its unique structure may influence its reactivity and interactions with biological systems, making it a subject of interest in medicinal chemistry and material science. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken.
Formula:C8H14O3
InChI:InChI=1/C8H14O3/c9-8(10)6-11-7-4-2-1-3-5-7/h7H,1-6H2,(H,9,10)
SMILES:C1CCC(CC1)OCC(=O)O
Synonyms:- Acetic acid, (cyclohexyloxy)-
- Acetic acid, 2-(cyclohexyloxy)-
- (Cyclohexyloxy)acetic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
CYCLOHEXYLOXY-ACETIC ACID
CAS:Formula:C8H14O3Purity:97%Color and Shape:LiquidMolecular weight:158.1950Cyclohexyloxy-acetic acid
CAS:Formula:C8H14O3Purity:97%(GC-MS);RGColor and Shape:LiquidMolecular weight:158.1972-(Cyclohexyloxy)acetic acid
CAS:2-(Cyclohexyloxy)acetic acid is a synthetic organic compound that has the chemical formula CH2OCH2COCH2OH. It is an acid catalyst with a pK of 1.6, and it can be used to catalyze the reaction between sodium carbonate and cyclohexanol. 2-(Cyclohexyloxy)acetic acid is also used as a solid catalyst in the conversion of ethyl diazoacetate to phenyl acetic acid. It has been shown to be effective for wastewater treatment, as well as for removal of nitrogen from wastewater. 2-(Cyclohexyloxy)acetic acid has been found to be toxic to aquatic organisms at relatively low concentrations, so care should be taken if this substance is released into the environment.Formula:C8H14O3Purity:Min. 95%Molecular weight:158.2 g/mol



