CymitQuimica logo

CAS 719999-54-9

:

tert-butyl [(2R)-pyrrolidin-2-ylmethyl]carbamate

Description:
Tert-butyl [(2R)-pyrrolidin-2-ylmethyl]carbamate is a chemical compound characterized by its carbamate functional group, which is derived from the reaction of a carbamic acid with an alcohol. This compound features a tert-butyl group, providing steric bulk, and a pyrrolidine ring, which contributes to its potential biological activity. The presence of the (2R) configuration indicates chirality, suggesting that the compound may exhibit specific interactions in biological systems, making it of interest in medicinal chemistry. Its molecular structure allows for hydrogen bonding and potential interactions with various biological targets. The compound is typically used in organic synthesis and may serve as a building block in the development of pharmaceuticals or agrochemicals. Additionally, its stability and solubility characteristics can influence its reactivity and application in various chemical reactions. Safety data and handling precautions should be considered, as with any chemical substance, to ensure proper laboratory practices.
Formula:C10H20N2O2
InChI:InChI=1/C10H20N2O2/c1-10(2,3)14-9(13)12-7-8-5-4-6-11-8/h8,11H,4-7H2,1-3H3,(H,12,13)/t8-/m1/s1
InChI key:DPJPFGHHTJLWQQ-MRVPVSSYSA-N
SMILES:CC(C)(C)OC(=NC[C@H]1CCCN1)O
Synonyms:
  • (R)-2-(Boc-aminomethyl)-pyrrolidine
  • Carbamic Acid, [(2R)-2-Pyrrolidinylmethyl]-, 1,1-Dimethylethyl Ester
Found 4 products.