CAS 72-84-4
:Uridine, 2′-deoxy-2′,5-difluoro-
Description:
Uridine, 2′-deoxy-2′,5-difluoro- is a modified nucleoside that belongs to the class of pyrimidine nucleosides. It is characterized by the presence of a ribofuranose sugar, which is deoxygenated at the 2′ position, and two fluorine atoms substituted at the 2′ and 5′ positions of the uracil base. This modification can influence the nucleoside's stability, binding affinity, and biological activity, making it of interest in various biochemical and pharmaceutical applications. The presence of fluorine atoms can enhance the lipophilicity and metabolic stability of the compound, potentially improving its efficacy in therapeutic contexts. Uridine derivatives are often studied for their roles in nucleic acid metabolism and their potential use in antiviral and anticancer therapies. The compound's CAS number, 72-84-4, is a unique identifier that facilitates its recognition in chemical databases and literature. Overall, 2′-deoxy-2′,5-difluoro-uridine represents a significant modification of natural uridine, with implications for research and drug development.
Formula:C9H10F2N2O5
InChI:InChI=1S/C9H10F2N2O5/c10-3-1-13(9(17)12-7(3)16)8-5(11)6(15)4(2-14)18-8/h1,4-6,8,14-15H,2H2,(H,12,16,17)/t4-,5-,6-,8-/m1/s1
InChI key:InChIKey=QURNODSOJKSTBM-UAKXSSHOSA-N
SMILES:F[C@H]1[C@@H](O[C@H](CO)[C@H]1O)N2C(=O)NC(=O)C(F)=C2
Synonyms:- 5-Fluoro-1-(2'-Fluoro-2'-Deoxyribofuranosyl)Uracil
- 5-Fluoro-2′-fluoro-2′-deoxyuridine
- Uridine, 2′-deoxy-2′,5-difluoro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.