CAS 720-73-0
:4'-fluorobiphenyl-4-carboxylate
Description:
4'-Fluorobiphenyl-4-carboxylate, with the CAS number 720-73-0, is an organic compound characterized by its biphenyl structure substituted with a fluorine atom and a carboxylate group. This compound typically exhibits a white to off-white crystalline appearance and is soluble in organic solvents, such as ethanol and acetone, but has limited solubility in water. The presence of the fluorine atom can influence its chemical reactivity and physical properties, such as melting point and boiling point, often enhancing its stability and lipophilicity. The carboxylate group contributes to its acidity and can participate in various chemical reactions, including esterification and nucleophilic substitution. This compound is of interest in various fields, including pharmaceuticals and materials science, due to its potential applications in synthesis and as a building block for more complex molecules. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken.
Formula:C13H9FO2
InChI:InChI=1/C13H9FO2/c14-12-7-5-10(6-8-12)9-1-3-11(4-2-9)13(15)16/h1-8H,(H,15,16)/p-1
SMILES:c1cc(ccc1c1ccc(cc1)F)C(=O)[O-]
Synonyms:- [1,1'-Biphenyl]-4-carboxylic acid, 4'-fluoro-
- 4'-Fluorobiphenyl-4-carboxylic acid
- 4-Biphenyl-4-Fluoro-Carboxylic Acid
- 4-(4-Fluorophenyl)benzoic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
4'-Methylbiphenyl-4-carboxylic acid, 96%
CAS:The 4'-methyl-biphenyl-4-carboxylic acid exhibits the characteristic absorption bands of COOH and CH, groups. Photoproduct analysis, carried out by GC-MS, ETIR and GC-FTIR confirm three successive oxidation states of methyl suhstituents such as alcohol, aldehyde and carboxylic acids. This Thermo Sci
Formula:C14H11O2Purity:96%Color and Shape:White, PowderMolecular weight:211.244′-Methylbiphenyl-4-carboxylic acid
CAS:Formula:C14H12O2Purity:97%Color and Shape:SolidMolecular weight:212.248[1,1'-Biphenyl]-4-carboxylicacid, 4'-methyl-
CAS:Formula:C14H12O2Purity:97%Color and Shape:SolidMolecular weight:212.24394'-Methyl-[1,1'-biphenyl]-4-carboxylic acid
CAS:4'-Methyl-[1,1'-biphenyl]-4-carboxylic acidPurity:98%Color and Shape:Colourless PowderMolecular weight:212.24g/mol



