CymitQuimica logo

CAS 72000-65-8

:

2,5-Pyrrolidinedicarboxylic acid

Description:
2,5-Pyrrolidinedicarboxylic acid, with the CAS number 72000-65-8, is a bicyclic organic compound characterized by a pyrrolidine ring with two carboxylic acid functional groups attached at the 2 and 5 positions. This compound is typically a white crystalline solid at room temperature and is soluble in water and various organic solvents, which enhances its utility in chemical reactions and formulations. The presence of the carboxylic acid groups contributes to its acidity and reactivity, allowing it to participate in various chemical transformations, including esterification and amidation. 2,5-Pyrrolidinedicarboxylic acid is of interest in the fields of organic synthesis and materials science, where it may serve as a building block for more complex molecules or as a potential intermediate in the synthesis of pharmaceuticals and agrochemicals. Additionally, its structural features may impart unique properties that can be exploited in polymer chemistry or as a ligand in coordination chemistry. Overall, this compound exhibits a combination of functional versatility and structural stability, making it a valuable substance in various chemical applications.
Formula:C6H9NO4
InChI:InChI=1/C6H9NO4/c8-5(9)3-1-2-4(7-3)6(10)11/h3-4,7H,1-2H2,(H,8,9)(H,10,11)
SMILES:C1CC(C(=O)O)NC1C(=O)O
Synonyms:
  • Pyrrolidine-2,5-dicarboxylic acid
  • 2,5-pyrrolidinedicarboxylic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.