CymitQuimica logo

CAS 72002-05-2

:

7-Bromobenzo[b]thiophen-3(2H)-one

Description:
7-Bromobenzo[b]thiophen-3(2H)-one is an organic compound characterized by its unique structure, which includes a bromine atom attached to a benzo[b]thiophene core. This compound features a thiophene ring fused to a benzene ring, with a carbonyl group (ketone) at the 3-position of the thiophene. The presence of the bromine substituent enhances its reactivity and can influence its physical and chemical properties, such as solubility and boiling point. Typically, compounds like this exhibit interesting biological activities, making them of interest in medicinal chemistry and materials science. The molecular structure contributes to its potential applications in various fields, including organic synthesis and pharmaceuticals. Additionally, the compound's stability and reactivity can be affected by the electronic effects of the bromine atom, which can participate in electrophilic aromatic substitution reactions. Overall, 7-Bromobenzo[b]thiophen-3(2H)-one is a notable compound due to its structural features and potential utility in chemical research.
Formula:C8H5BrOS
InChI:InChI=1S/C8H5BrOS/c9-6-3-1-2-5-7(10)4-11-8(5)6/h1-3H,4H2
InChI key:InChIKey=UHBOWTAECPTWGL-UHFFFAOYSA-N
SMILES:BrC1=C2C(C(=O)CS2)=CC=C1
Synonyms:
  • Benzo[b]thiophen-3(2H)-one, 7-bromo-
  • 7-Bromobenzo[b]thiophen-3(2H)-one
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.