CAS 72002-23-4

N-(2,4,6-Tribromophenyl)formamide

Description:

N-(2,4,6-Tribromophenyl)formamide is an organic compound characterized by the presence of a formamide functional group attached to a phenyl ring that is heavily brominated at the 2, 4, and 6 positions. This compound typically exhibits a high degree of bromination, which significantly influences its chemical properties, including increased hydrophobicity and potential biological activity. The presence of multiple bromine atoms can enhance the compound's stability and alter its reactivity, making it of interest in various fields such as medicinal chemistry and materials science. It may also exhibit unique spectral properties, making it suitable for analytical applications. Additionally, due to the presence of the formamide group, it can participate in hydrogen bonding, which may affect its solubility and interaction with other molecules. Safety considerations should be taken into account when handling this compound, as brominated compounds can pose environmental and health risks. Overall, N-(2,4,6-Tribromophenyl)formamide is a notable compound for its structural features and potential applications in research and industry.

Formula: C₇H₄Br₃NO

InChI: InChI=1S/C7H4Br3NO/c8-4-1-5(9)7(11-3-12)6(10)2-4/h1-3H,(H,11,12)

InChI key: InChIKey=CNORRCOAHWUWLT-UHFFFAOYSA-N

SMILES: N(C=O)C1=C(Br)C=C(Br)C=C1Br

Synonyms:

• N-(2,4,6-Tribromophenyl)formamide
• Formamide, N-(2,4,6-tribromophenyl)-