CAS 72002-36-9
:(3S,3′S)-Zeaxanthin
Description:
(3S,3′S)-Zeaxanthin is a carotenoid, a class of pigments found in various plants and microorganisms, known for its role in photosynthesis and as an antioxidant. This compound is characterized by its vibrant yellow-orange color and is primarily found in green leafy vegetables, corn, and egg yolks. It has a molecular formula that reflects its complex structure, which includes multiple conjugated double bonds that contribute to its light-absorbing properties. Zeaxanthin is stereoisomeric, with specific configurations at its chiral centers, which influence its biological activity and interaction with light. It plays a crucial role in human health, particularly in eye health, as it is known to filter harmful blue light and protect against oxidative stress in retinal tissues. Additionally, zeaxanthin is recognized for its potential benefits in reducing the risk of age-related macular degeneration and improving visual performance. Its antioxidant properties also contribute to overall cellular health, making it a subject of interest in nutritional and pharmaceutical research.
Formula:C40H56O2
InChI:InChI=1S/C40H56O2/c1-29(17-13-19-31(3)21-23-37-33(5)25-35(41)27-39(37,7)8)15-11-12-16-30(2)18-14-20-32(4)22-24-38-34(6)26-36(42)28-40(38,9)10/h11-24,35-36,41-42H,25-28H2,1-10H3/b12-11+,17-13+,18-14+,23-21+,24-22+,29-15+,30-16+,31-19+,32-20+/t35-,36-/m0/s1
InChI key:InChIKey=JKQXZKUSFCKOGQ-ANDPMPNWSA-N
SMILES:C(=C/C(=C/C=C/C(=C/C=C/C=C(/C=C/C=C(/C=C/C=1C(C)(C)C[C@@H](O)CC1C)\C)\C)/C)/C)\C=2C(C)(C)C[C@@H](O)CC2C
Synonyms:- (3S,3′S)-β,β-Carotene-3,3′-diol
- β,β-Carotene-3,3′-diol, (3S,3′S)-
- (3S,3′S)-Zeaxanthin
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
