CAS 72010-18-5
:2-Propyl-2,4-pentadienoic acid
Description:
2-Propyl-2,4-pentadienoic acid, also known as 2-propyl-2,4-pentadienoic acid, is an organic compound characterized by its unsaturated carboxylic acid structure. It features a five-carbon chain with two double bonds located at the 2 and 4 positions, along with a propyl group attached to the second carbon. This compound is typically a colorless to pale yellow liquid and is known for its strong odor. It is soluble in organic solvents but has limited solubility in water due to its hydrophobic propyl group. The presence of the carboxylic acid functional group imparts acidic properties, allowing it to participate in various chemical reactions, including esterification and polymerization. 2-Propyl-2,4-pentadienoic acid is of interest in organic synthesis and may be utilized in the production of various chemical intermediates or as a building block in the synthesis of more complex molecules. Safety data indicates that, like many unsaturated acids, it should be handled with care due to potential irritant properties.
Formula:C8H12O2
InChI:InChI=1S/C8H12O2/c1-3-5-7(6-4-2)8(9)10/h3,5H,1,4,6H2,2H3,(H,9,10)
InChI key:InChIKey=UUILWXIBBZVJDU-UHFFFAOYSA-N
SMILES:C(CCC)(=CC=C)C(O)=O
Synonyms:- 2,4-Pentadienoic acid, 2-propyl-
- 2-Propyl-2,4-Pentadienoic Acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
(E,Z)-2-Propyl-2,4-pentadienoic acid
CAS:(E,Z)-2-Propyl-2,4-pentadienoic acid is a reactive metabolite of the fatty acid linoleic acid. It is formed by oxidation of linoleic acid in the cytosol and can be found in human serum and urine samples. (E,Z)-2-Propyl-2,4-pentadienoic acid has been shown to have diagnostic potential in metabolic disorders such as diabetes mellitus type 2 and familial hypercholesterolemia. The concentration of this metabolite can be measured using gas chromatography with mass spectrometry detection. This analytical method has a high specificity and sensitivity for (E,Z)-2-propyl-2,4-pentadienoic acid.Formula:C8H12O2Purity:Min. 95%Color and Shape:Clear Viscous LiquidMolecular weight:140.18 g/mol
