CAS 72016-54-7
:(3R)-3-fluoro-L-asparagine
Description:
(3R)-3-fluoro-L-asparagine is an amino acid derivative characterized by the presence of a fluorine atom at the 3-position of the asparagine backbone. This compound is an analog of the naturally occurring amino acid L-asparagine, which plays a crucial role in protein synthesis and metabolism. The fluorine substitution can influence the compound's biochemical properties, potentially affecting its interactions with enzymes and receptors. As a polar molecule, (3R)-3-fluoro-L-asparagine is soluble in water, which is typical for amino acids due to their ability to form hydrogen bonds. Its chirality, indicated by the (3R) designation, suggests that it exists in a specific three-dimensional orientation, which can be significant for its biological activity. This compound may be of interest in pharmaceutical research, particularly in the development of drugs targeting metabolic pathways or in studies exploring the effects of fluorinated amino acids on protein structure and function. Overall, (3R)-3-fluoro-L-asparagine represents a valuable tool in both biochemical research and potential therapeutic applications.
Formula:C4H7FN2O3
InChI:InChI=1/C4H7FN2O3/c5-1(3(7)8)2(6)4(9)10/h1-2H,6H2,(H2,7,8)(H,9,10)/t1-,2+/m1/s1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.