
CAS 7203-91-0
:4-(3,3-Dimethyl-1-triazen-1-yl)benzoic acid
Description:
4-(3,3-Dimethyl-1-triazen-1-yl)benzoic acid, with the CAS number 7203-91-0, is an organic compound characterized by its triazene functional group and a benzoic acid moiety. This compound typically appears as a solid and is known for its potential applications in various fields, including pharmaceuticals and materials science. The presence of the triazene group imparts unique chemical reactivity, particularly in the context of azo coupling reactions, which can be utilized in dye synthesis. The benzoic acid portion contributes to the compound's acidity and solubility properties, influencing its behavior in different solvents. Additionally, the dimethyl substitution on the triazene nitrogen atoms can affect the stability and reactivity of the compound, making it of interest in studies related to chemical stability and reactivity. Overall, this compound exemplifies the interplay between structural features and chemical properties, making it a subject of interest in both synthetic and applied chemistry.
Formula:C9H11N3O2
InChI:InChI=1S/C9H11N3O2/c1-12(2)11-10-8-5-3-7(4-6-8)9(13)14/h3-6H,1-2H3,(H,13,14)
InChI key:InChIKey=GUAZPUYTLMUTMA-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=CC=C(N=NN(C)C)C=C1
Synonyms:- 4-(3,3-Dimethyl-1-triazen-1-yl)benzoic acid
- Benzoic acid, 4-(3,3-dimethyl-1-triazenyl)-
- 4′-Carboxy-1-phenyl-3,3-dimethyltriazene
- Benzoic acid, 4-(3,3-dimethyl-1-triazen-1-yl)-
- Benzoic acid, p-(3,3-dimethyl-1-triazeno)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
