
CAS 7204-29-7
:2-Buten-1-ol, 1-acetate, (2E)-
Description:
2-Buten-1-ol, 1-acetate, (2E)- is an organic compound characterized by its structure, which features a butene backbone with a hydroxyl group and an acetate functional group. This compound is classified as an unsaturated alcohol due to the presence of a double bond between the second and third carbon atoms in the butene chain. The (2E) designation indicates the specific geometric configuration of the double bond, which is in the trans (E) configuration. This compound is typically colorless and may have a sweet, fruity odor, making it relevant in flavor and fragrance applications. It is soluble in organic solvents and may exhibit moderate volatility. In terms of reactivity, 2-buten-1-ol, 1-acetate can participate in various chemical reactions typical of alcohols and esters, such as esterification and dehydration. Its properties make it useful in synthetic organic chemistry and potentially in the production of other chemical intermediates. Safety data should be consulted for handling and storage, as with all chemical substances.
Formula:C6H10O2
InChI:InChI=1S/C6H10O2/c1-3-4-5-8-6(2)7/h3-4H,5H2,1-2H3/b4-3+
InChI key:InChIKey=WNHXJHGRIHUOTG-ONEGZZNKSA-N
SMILES:O(C/C=C/C)C(C)=O
Synonyms:- 2-Buten-1-ol, acetate, (E)-
- 2-Buten-1-ol, 1-acetate, (2E)-
- 2-Buten-1-ol, acetate, (2E)-
- (E)-1-Acetoxy-2-butene
- trans-Crotyl acetate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.