CymitQuimica logo

CAS 7205-62-1

:

Benzene, 1-chloro-4-[(1-methylethyl)thio]-

Description:
Benzene, 1-chloro-4-[(1-methylethyl)thio]- is an organic compound characterized by its aromatic benzene ring substituted with a chlorine atom and a thioether group. The presence of the chlorine atom introduces a polar functional group, which can influence the compound's reactivity and solubility in various solvents. The thioether group, derived from isopropyl mercaptan, contributes to the compound's unique properties, including potential applications in organic synthesis and as an intermediate in chemical manufacturing. This compound is typically colorless to pale yellow and may have a characteristic odor associated with aromatic compounds. Its chemical behavior is influenced by both the electron-withdrawing nature of the chlorine and the electron-donating properties of the thioether group, which can affect its reactivity in nucleophilic substitution reactions. Safety considerations include handling it in well-ventilated areas and using appropriate personal protective equipment, as it may pose health risks upon exposure. Overall, this compound exemplifies the diverse chemistry of substituted benzenes.
Formula:C9H11ClS
InChI:InChI=1S/C9H11ClS/c1-7(2)11-9-5-3-8(10)4-6-9/h3-7H,1-2H3
InChI key:ZWKPKISWPZWKLB-UHFFFAOYSA-N
SMILES:CC(C)SC1=CC=C(C=C1)Cl
Found 4 products.