CAS 72054-56-9

4-(2-bromoethyl)benzonitrile

Description:

4-(2-Bromoethyl)benzonitrile, with the CAS number 72054-56-9, is an organic compound characterized by its aromatic structure and the presence of both a bromine atom and a nitrile functional group. This compound features a benzene ring substituted with a 2-bromoethyl group and a cyano group (-C≡N) at the para position. The bromine atom contributes to its reactivity, making it a useful intermediate in organic synthesis, particularly in the formation of carbon-carbon bonds. The nitrile group imparts polar characteristics, enhancing its solubility in polar solvents. Additionally, the compound may exhibit moderate toxicity due to the presence of bromine and the nitrile group, necessitating careful handling. Its physical properties, such as melting point and boiling point, are influenced by the molecular structure and substituents. Overall, 4-(2-bromoethyl)benzonitrile serves as a valuable building block in the synthesis of pharmaceuticals and agrochemicals, highlighting its significance in chemical research and industry.

Formula: C₉H₈BrN

InChI: InChI=1/C9H8BrN/c10-6-5-8-1-3-9(7-11)4-2-8/h1-4H,5-6H2

SMILES: c1cc(ccc1CCBr)C#N

Synonyms:

• Benzonitrile, 4-(2-Bromoethyl)-

4-(2-Bromoethyl)benzonitrile

CAS: 72054-56-9

Formula: C₉H₈BrN

Purity: 97%

Color and Shape: Solid

Molecular weight: 210.0705

Ref: IN-DA005DBI

4-(2-Bromoethyl)benzonitrile

CAS: 72054-56-9

4-(2-Bromoethyl)benzonitrile

Formula: C₉H₈BrN

Purity: 99%

Color and Shape: white to off-white solid

Molecular weight: 210.07g/mol

Ref: 54-OR45144

4-(2-Bromoethyl)benzonitrile

CAS: 72054-56-9

Formula: C₉H₈BrN

Purity: 97%

Color and Shape: Solid

Molecular weight: 210.074

Ref: 10-F220041