
CAS 72059-10-0
:rel-(αR,1S)-α,4-Dimethyl-α-(4-methyl-3-penten-1-yl)-3-cyclohexene-1-methanol
Description:
Rel-(αR,1S)-α,4-Dimethyl-α-(4-methyl-3-penten-1-yl)-3-cyclohexene-1-methanol, with the CAS number 72059-10-0, is a complex organic compound characterized by its unique bicyclic structure and multiple substituents. This substance features a cyclohexene ring, which contributes to its cyclic nature and potential for stereoisomerism due to the presence of chiral centers. The presence of multiple methyl groups and a pentenyl side chain indicates that it may exhibit hydrophobic characteristics, influencing its solubility in organic solvents rather than in water. The hydroxyl (-OH) group in the structure suggests that it can participate in hydrogen bonding, which may affect its reactivity and interactions with other molecules. This compound may be of interest in various fields, including organic synthesis and fragrance chemistry, due to its potential applications in creating complex scents or as a precursor in synthetic pathways. Its specific physical and chemical properties, such as boiling point, melting point, and reactivity, would require empirical measurement or detailed computational analysis for precise characterization.
Formula:C15H26O
InChI:InChI=1/C15H26O/c1-12(2)6-5-11-15(4,16)14-9-7-13(3)8-10-14/h6-7,14,16H,5,8-11H2,1-4H3/t14-,15-/s2
InChI key:InChIKey=RGZSQWQPBWRIAQ-PTTDRDKLNA-N
SMILES:[C@@](CCC=C(C)C)(C)(O)[C@]1(CCC(C)=CC1)[H]
Synonyms:- rel-(αR,1S)-α,4-Dimethyl-α-(4-methyl-3-penten-1-yl)-3-cyclohexene-1-methanol
- 3-Cyclohexene-1-methanol, α,4-dimethyl-α-(4-methyl-3-pentenyl)-, (R*,S*)-(±)-
- 3-Cyclohexene-1-methanol, α,4-dimethyl-α-(4-methyl-3-pentenyl)-, (αR,1S)-rel-
- 3-Cyclohexene-1-methanol, α,4-dimethyl-α-(4-methyl-3-penten-1-yl)-, (αR,1S)-rel-
- 3-Cyclohexene-1-methanol, α,4-dimethyl-α-(4-methyl-3-pentenyl)-, (R*,S*)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
(alphaR,1R)-α-Bisabolol-D3
CAS:Controlled ProductFormula:C15H23D3OColor and Shape:NeatMolecular weight:225.39
