
CAS 720660-14-0
:3-Amino-2,2-dimethylbutanoic acid
Description:
3-Amino-2,2-dimethylbutanoic acid, also known as ADDA (Amino-Dimethyl-Butanoic Acid), is an amino acid derivative characterized by its branched structure, which includes a central carbon atom bonded to an amino group, a carboxylic acid group, and two methyl groups. This compound is typically a white crystalline solid at room temperature and is soluble in water due to the presence of the polar carboxylic acid and amino groups. It exhibits properties typical of amino acids, such as the ability to participate in peptide bond formation, making it relevant in biochemical applications. The presence of the dimethyl groups contributes to its steric hindrance, which can influence its reactivity and interactions with other molecules. Additionally, 3-Amino-2,2-dimethylbutanoic acid may have applications in pharmaceuticals, biochemistry, and as a building block in the synthesis of peptides or other complex organic compounds. Its unique structure and properties make it a subject of interest in various fields of research.
Formula:C6H13NO2
InChI:InChI=1S/C6H13NO2/c1-4(7)6(2,3)5(8)9/h4H,7H2,1-3H3,(H,8,9)
InChI key:InChIKey=JQRDIZQROJQBDM-UHFFFAOYSA-N
SMILES:C(C(C)N)(C(O)=O)(C)C
Synonyms:- Butanoic acid, 3-amino-2,2-dimethyl-
- 3-Amino-2,2-dimethylbutanoic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.