CAS 720690-73-3
:6-[(3-Cyclobutyl-2,3,4,5-tetrahydro-1H-3-benzazepin-7-yl)oxy]-N-methyl-3-pyridinecarboxamide
Description:
The chemical substance known as 6-[(3-Cyclobutyl-2,3,4,5-tetrahydro-1H-3-benzazepin-7-yl)oxy]-N-methyl-3-pyridinecarboxamide, with the CAS number 720690-73-3, is a complex organic compound characterized by its unique structural features. It contains a pyridine ring, which is a six-membered aromatic ring with one nitrogen atom, and a benzazepine moiety, indicating a fused bicyclic structure that includes both benzene and azepine components. The presence of a cyclobutyl group adds to its structural diversity, contributing to its potential biological activity. This compound is likely to exhibit specific pharmacological properties due to its intricate arrangement of functional groups, including an amide linkage and an ether bond. Such characteristics may influence its solubility, stability, and interaction with biological targets. The compound's synthesis and characterization would typically involve advanced organic chemistry techniques, and its potential applications could span medicinal chemistry, particularly in the development of therapeutic agents. Further studies would be necessary to elucidate its specific biological effects and mechanisms of action.
Formula:C21H25N3O2
InChI:InChI=1S/C21H25N3O2/c1-22-21(25)17-6-8-20(23-14-17)26-19-7-5-15-9-11-24(18-3-2-4-18)12-10-16(15)13-19/h5-8,13-14,18H,2-4,9-12H2,1H3,(H,22,25)
InChI key:InChIKey=WROHEWWOCPRMIA-UHFFFAOYSA-N
SMILES:O(C=1C=C2C(CCN(CC2)C3CCC3)=CC1)C4=CC=C(C(NC)=O)C=N4
Synonyms:- 6-[(3-Cyclobutyl-2,3,4,5-tetrahydro-1H-3-benzazepin-7-yl)oxy]-N-methyl-3-pyridinecarboxamide
- 3-Pyridinecarboxamide, 6-[(3-cyclobutyl-2,3,4,5-tetrahydro-1H-3-benzazepin-7-yl)oxy]-N-methyl-
- GSK 189254A
- GSK 189254 free base
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
GSK189254A
CAS:GSK189254A (GSK189254) is a potent and specific histamine H3 receptor antagonist (pKi values: 9.59-9.90 and 8.51-9.17 for human and rat H3).Formula:C21H25N3O2Purity:98.71% - 99.858%Color and Shape:SolidMolecular weight:351.44Ref: TM-TQ0066
1mg52.00€5mg88.00€10mg120.00€25mg216.00€50mg350.00€100mg505.00€200mg727.00€1mL*10mM (DMSO)67.00€GSK189254A
CAS:GSK189254A is a drug that is a novel, potent, and selective H3 receptor antagonist. GSK189254A has a high affinity for the H3 receptor and can be used to treat chronic diseases such as schizophrenia and Alzheimer's disease. GSK189254A has been shown to block histamine-induced increases in striatal dopamine concentration in rats. It also blocks 3-methoxyphenylacetic acid binding to the H3 receptor with an IC50 of 1 nM. GSK189254A has undergone clinical trials in humans and was found to have pharmacokinetic properties similar to other established drugs that are used for the treatment of schizophrenia.Formula:C21H25N3O2Purity:Min. 95%Molecular weight:351.44 g/mol



