CAS 720693-05-0

6-Chloro-N-ethyl-N-methyl-3-pyridinecarboxamide

Description:

6-Chloro-N-ethyl-N-methyl-3-pyridinecarboxamide is a chemical compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. The presence of the chloro group at the 6-position of the pyridine ring introduces a halogen, which can influence the compound's reactivity and biological activity. The N-ethyl and N-methyl substituents indicate that the compound has two alkyl groups attached to the nitrogen atom, which can affect its solubility and interaction with biological systems. This compound may exhibit properties typical of amides, such as hydrogen bonding capabilities, which can influence its physical and chemical behavior. Additionally, the presence of the carboxamide functional group suggests potential applications in medicinal chemistry, possibly as a pharmaceutical agent. The specific characteristics, such as melting point, boiling point, and solubility, would depend on the molecular interactions and the overall structure of the compound. As with many chemical substances, safety data and handling precautions should be considered when working with this compound.

Formula: C₉H₁₁ClN₂O

InChI: InChI=1S/C9H11ClN2O/c1-3-12(2)9(13)7-4-5-8(10)11-6-7/h4-6H,3H2,1-2H3

InChI key: InChIKey=KRBIGUVPPLFHHE-UHFFFAOYSA-N

SMILES: C(N(CC)C)(=O)C=1C=CC(Cl)=NC1

Synonyms:

• 3-Pyridinecarboxamide, 6-chloro-N-ethyl-N-methyl-
• 6-Chloro-N-ethyl-N-methylnicotinamide
• 6-Chloro-N-ethyl-N-methyl-3-pyridinecarboxamide