CAS 720693-07-2

(6-Chloro-2-pyridinyl)-1-pyrrolidinylmethanone

Description:

(6-Chloro-2-pyridinyl)-1-pyrrolidinylmethanone, with the CAS number 720693-07-2, is a chemical compound characterized by its unique structural features, which include a pyridine ring substituted with a chlorine atom and a pyrrolidine moiety. This compound typically exhibits properties associated with both heterocyclic and aromatic compounds, including potential biological activity due to its ability to interact with various biological targets. The presence of the chloro group may influence its reactivity and solubility, while the pyrrolidinyl group can contribute to its pharmacological properties. Such compounds are often studied for their potential applications in medicinal chemistry, particularly in the development of new therapeutic agents. The specific characteristics, such as melting point, boiling point, and solubility, would depend on the compound's purity and the conditions under which it is analyzed. Overall, this compound represents a class of molecules that may have significant implications in drug discovery and development.

Formula: C₁₀H₁₁ClN₂O

InChI: InChI=1S/C10H11ClN2O/c11-9-5-3-4-8(12-9)10(14)13-6-1-2-7-13/h3-5H,1-2,6-7H2

InChI key: InChIKey=VAVUXLLJDSQEEP-UHFFFAOYSA-N

SMILES: C(=O)(C=1N=C(Cl)C=CC1)N2CCCC2

Synonyms:

• Methanone, (6-chloro-2-pyridinyl)-1-pyrrolidinyl-
• (6-Chloro-2-pyridinyl)-1-pyrrolidinylmethanone
• Pyrrolidine, 1-[(6-chloro-2-pyridinyl)carbonyl]-
• 1-(6-Chloropyridin-2-yl)-1-(pyrrolidin-1-yl)methanone
• 2-Chloro-6-(pyrrolidine-1-carbonyl)pyridine